C18H12N6O7 — CID 23723893
1,7-phenanthrolin-8-amine;2,4,6-trinitrophenol (PubChem CID 23723893) has the molecular formula C18H12N6O7 and a molecular weight of 424.33 g/mol. Its IUPAC name is 1,7-phenanthrolin-8-amine;2,4,6-trinitrophenol.
| Compound Name | 1,7-phenanthrolin-8-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 23723893 |
| Molecular Formula | C18H12N6O7 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 1,7-phenanthrolin-8-amine;2,4,6-trinitrophenol |
| SMILES | Nc1ccc2c(ccc3cccnc32)n1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9N3.C6H3N3O7/c13-11-6-4-9-10(15-11)5-3-8-2-1-7-14-12(8)9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-7H,(H2,13,15);1-2,10H |
| InChIKey | WCEGEOXQHZHQFT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 201.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|