About europium(3+);1,7-phenanthroline;trinitrate
europium(3+);1,7-phenanthroline;trinitrate (PubChem CID 174550774) has the molecular formula C12H8EuN5O9
and a molecular weight of 518.19 g/mol. Its IUPAC name is europium(3+);1,7-phenanthroline;trinitrate.
Molecular Properties
| Compound Name | europium(3+);1,7-phenanthroline;trinitrate |
| PubChem CID | 174550774 |
| Molecular Formula | C12H8EuN5O9 |
| Molecular Weight | 518.19 g/mol |
| Exact Mass | 518.95 |
| IUPAC Name | europium(3+);1,7-phenanthroline;trinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Eu+3].c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.Eu.3NO3/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;;3*2-1(3)4/h1-8H;;;;/q;+3;3*-1 |
| InChIKey | ACGIDGSPLSOAKH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 224.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze europium(3+);1,7-phenanthroline;trinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of europium(3+);1,7-phenanthroline;trinitrate?
The IUPAC name of europium(3+);1,7-phenanthroline;trinitrate (CID 174550774) is europium(3+);1,7-phenanthroline;trinitrate.
What is the SMILES notation for europium(3+);1,7-phenanthroline;trinitrate?
The canonical SMILES for europium(3+);1,7-phenanthroline;trinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Eu+3].c1cnc2c(c1)ccc1ncccc12.
What is the InChIKey of europium(3+);1,7-phenanthroline;trinitrate?
The InChIKey is ACGIDGSPLSOAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.Eu.3NO3/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;;3*2-1(3)4/h1-8H;;;;/q;+3;3*-1.
What are the key properties of europium(3+);1,7-phenanthroline;trinitrate?
europium(3+);1,7-phenanthroline;trinitrate has a molecular weight of 518.19 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for europium(3+);1,7-phenanthroline;trinitrate is sourced from PubChem (CID 174550774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).