About benzo[h]quinoline;naphthalene
benzo[h]quinoline;naphthalene (PubChem CID 175017782) has the molecular formula C23H17N
and a molecular weight of 307.40 g/mol. Its IUPAC name is benzo[h]quinoline;naphthalene.
Molecular Properties
| Compound Name | benzo[h]quinoline;naphthalene |
| PubChem CID | 175017782 |
| Molecular Formula | C23H17N |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | benzo[h]quinoline;naphthalene |
| SMILES | c1ccc2c(c1)ccc1cccnc12.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H9N.C10H8/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;1-2-6-10-8-4-3-7-9(10)5-1/h1-9H;1-8H |
| InChIKey | QPDZFSALTYOJIA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[h]quinoline;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[h]quinoline;naphthalene?
The IUPAC name of benzo[h]quinoline;naphthalene (CID 175017782) is benzo[h]quinoline;naphthalene.
What is the SMILES notation for benzo[h]quinoline;naphthalene?
The canonical SMILES for benzo[h]quinoline;naphthalene is c1ccc2c(c1)ccc1cccnc12.c1ccc2ccccc2c1.
What is the InChIKey of benzo[h]quinoline;naphthalene?
The InChIKey is QPDZFSALTYOJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C10H8/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12;1-2-6-10-8-4-3-7-9(10)5-1/h1-9H;1-8H.
What are the key properties of benzo[h]quinoline;naphthalene?
benzo[h]quinoline;naphthalene has a molecular weight of 307.40 g/mol, XLogP of 6.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[h]quinoline;naphthalene is sourced from PubChem (CID 175017782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).