About 1,7-phenanthroline;dihydrochloride
1,7-phenanthroline;dihydrochloride (PubChem CID 174688507) has the molecular formula C12H10Cl2N2
and a molecular weight of 253.13 g/mol. Its IUPAC name is 1,7-phenanthroline;dihydrochloride.
Molecular Properties
| Compound Name | 1,7-phenanthroline;dihydrochloride |
| PubChem CID | 174688507 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 1,7-phenanthroline;dihydrochloride |
| SMILES | Cl.Cl.c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.2ClH/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;;/h1-8H;2*1H |
| InChIKey | FXQTVQWRJKPAOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,7-phenanthroline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-phenanthroline;dihydrochloride?
The IUPAC name of 1,7-phenanthroline;dihydrochloride (CID 174688507) is 1,7-phenanthroline;dihydrochloride.
What is the SMILES notation for 1,7-phenanthroline;dihydrochloride?
The canonical SMILES for 1,7-phenanthroline;dihydrochloride is Cl.Cl.c1cnc2c(c1)ccc1ncccc12.
What is the InChIKey of 1,7-phenanthroline;dihydrochloride?
The InChIKey is FXQTVQWRJKPAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.2ClH/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;;/h1-8H;2*1H.
What are the key properties of 1,7-phenanthroline;dihydrochloride?
1,7-phenanthroline;dihydrochloride has a molecular weight of 253.13 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-phenanthroline;dihydrochloride is sourced from PubChem (CID 174688507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).