About benzo[g]pteridine;1,7-phenanthroline
benzo[g]pteridine;1,7-phenanthroline (PubChem CID 69047537) has the molecular formula C22H14N6
and a molecular weight of 362.40 g/mol. Its IUPAC name is benzo[g]pteridine;1,7-phenanthroline.
Molecular Properties
| Compound Name | benzo[g]pteridine;1,7-phenanthroline |
| PubChem CID | 69047537 |
| Molecular Formula | C22H14N6 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | benzo[g]pteridine;1,7-phenanthroline |
| SMILES | c1ccc2nc3ncncc3nc2c1.c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.C10H6N4/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;1-2-4-8-7(3-1)13-9-5-11-6-12-10(9)14-8/h1-8H;1-6H |
| InChIKey | FEQSKEOZGNLBIL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[g]pteridine;1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g]pteridine;1,7-phenanthroline?
The IUPAC name of benzo[g]pteridine;1,7-phenanthroline (CID 69047537) is benzo[g]pteridine;1,7-phenanthroline.
What is the SMILES notation for benzo[g]pteridine;1,7-phenanthroline?
The canonical SMILES for benzo[g]pteridine;1,7-phenanthroline is c1ccc2nc3ncncc3nc2c1.c1cnc2c(c1)ccc1ncccc12.
What is the InChIKey of benzo[g]pteridine;1,7-phenanthroline?
The InChIKey is FEQSKEOZGNLBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C10H6N4/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;1-2-4-8-7(3-1)13-9-5-11-6-12-10(9)14-8/h1-8H;1-6H.
What are the key properties of benzo[g]pteridine;1,7-phenanthroline?
benzo[g]pteridine;1,7-phenanthroline has a molecular weight of 362.40 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g]pteridine;1,7-phenanthroline is sourced from PubChem (CID 69047537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).