About pyrido[3,2-h]quinazoline
pyrido[3,2-h]quinazoline (PubChem CID 55297723) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is pyrido[3,2-h]quinazoline.
Molecular Properties
| Compound Name | pyrido[3,2-h]quinazoline |
| PubChem CID | 55297723 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | pyrido[3,2-h]quinazoline |
| SMILES | c1cnc2c(c1)ccc1cncnc12 |
| InChI | InChI=1S/C11H7N3/c1-2-8-3-4-9-6-12-7-14-11(9)10(8)13-5-1/h1-7H |
| InChIKey | XEJJWKBPMCMSJA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrido[3,2-h]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,2-h]quinazoline?
The IUPAC name of pyrido[3,2-h]quinazoline (CID 55297723) is pyrido[3,2-h]quinazoline.
What is the SMILES notation for pyrido[3,2-h]quinazoline?
The canonical SMILES for pyrido[3,2-h]quinazoline is c1cnc2c(c1)ccc1cncnc12.
What is the InChIKey of pyrido[3,2-h]quinazoline?
The InChIKey is XEJJWKBPMCMSJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3/c1-2-8-3-4-9-6-12-7-14-11(9)10(8)13-5-1/h1-7H.
What are the key properties of pyrido[3,2-h]quinazoline?
pyrido[3,2-h]quinazoline has a molecular weight of 181.20 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,2-h]quinazoline is sourced from PubChem (CID 55297723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).