C11H7N3 — CID 151797185
4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene (PubChem CID 151797185) has the molecular formula C11H7N3 and a molecular weight of 181.20 g/mol. Its IUPAC name is 4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 151797185 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1,3,5,7,9,11,13-heptaene |
| SMILES | c1cnc2c3cncc-3cncc2c1 |
| InChI | InChI=1S/C11H7N3/c1-2-8-4-12-5-9-6-13-7-10(9)11(8)14-3-1/h1-7H |
| InChIKey | RXVPJLKGMDXHRH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |