About ethane;1,6-naphthyridin-8-ol
ethane;1,6-naphthyridin-8-ol (PubChem CID 90698310) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is ethane;1,6-naphthyridin-8-ol.
Molecular Properties
| Compound Name | ethane;1,6-naphthyridin-8-ol |
| PubChem CID | 90698310 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | ethane;1,6-naphthyridin-8-ol |
| SMILES | CC.CC.Oc1cncc2cccnc12 |
| InChI | InChI=1S/C8H6N2O.2C2H6/c11-7-5-9-4-6-2-1-3-10-8(6)7;2*1-2/h1-5,11H;2*1-2H3 |
| InChIKey | PYJAVKRFKONJJY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1,6-naphthyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,6-naphthyridin-8-ol?
The IUPAC name of ethane;1,6-naphthyridin-8-ol (CID 90698310) is ethane;1,6-naphthyridin-8-ol.
What is the SMILES notation for ethane;1,6-naphthyridin-8-ol?
The canonical SMILES for ethane;1,6-naphthyridin-8-ol is CC.CC.Oc1cncc2cccnc12.
What is the InChIKey of ethane;1,6-naphthyridin-8-ol?
The InChIKey is PYJAVKRFKONJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.2C2H6/c11-7-5-9-4-6-2-1-3-10-8(6)7;2*1-2/h1-5,11H;2*1-2H3.
What are the key properties of ethane;1,6-naphthyridin-8-ol?
ethane;1,6-naphthyridin-8-ol has a molecular weight of 206.29 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,6-naphthyridin-8-ol is sourced from PubChem (CID 90698310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).