C8H6N2O2S — CID 67246302
1,6-naphthyridine-8-sulfinic acid (PubChem CID 67246302) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is 1,6-naphthyridine-8-sulfinic acid.
| Compound Name | 1,6-naphthyridine-8-sulfinic acid |
|---|---|
| PubChem CID | 67246302 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 1,6-naphthyridine-8-sulfinic acid |
| SMILES | O=S(O)c1cncc2cccnc12 |
| InChI | InChI=1S/C8H6N2O2S/c11-13(12)7-5-9-4-6-2-1-3-10-8(6)7/h1-5H,(H,11,12) |
| InChIKey | HDXPFPBBKJVBFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|