About quinazoline-8-sulfinic acid
quinazoline-8-sulfinic acid (PubChem CID 57009090) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is quinazoline-8-sulfinic acid.
Molecular Properties
| Compound Name | quinazoline-8-sulfinic acid |
| PubChem CID | 57009090 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | quinazoline-8-sulfinic acid |
| SMILES | O=S(O)c1cccc2cncnc12 |
| InChI | InChI=1S/C8H6N2O2S/c11-13(12)7-3-1-2-6-4-9-5-10-8(6)7/h1-5H,(H,11,12) |
| InChIKey | YFNKWXRTNGVBNE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze quinazoline-8-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazoline-8-sulfinic acid?
The IUPAC name of quinazoline-8-sulfinic acid (CID 57009090) is quinazoline-8-sulfinic acid.
What is the SMILES notation for quinazoline-8-sulfinic acid?
The canonical SMILES for quinazoline-8-sulfinic acid is O=S(O)c1cccc2cncnc12.
What is the InChIKey of quinazoline-8-sulfinic acid?
The InChIKey is YFNKWXRTNGVBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c11-13(12)7-3-1-2-6-4-9-5-10-8(6)7/h1-5H,(H,11,12).
What are the key properties of quinazoline-8-sulfinic acid?
quinazoline-8-sulfinic acid has a molecular weight of 194.22 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinazoline-8-sulfinic acid is sourced from PubChem (CID 57009090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).