About 8-(difluoromethyl)-1,6-naphthyridine
8-(difluoromethyl)-1,6-naphthyridine (PubChem CID 163747519) has the molecular formula C9H6F2N2
and a molecular weight of 180.16 g/mol. Its IUPAC name is 8-(difluoromethyl)-1,6-naphthyridine.
Molecular Properties
| Compound Name | 8-(difluoromethyl)-1,6-naphthyridine |
| PubChem CID | 163747519 |
| Molecular Formula | C9H6F2N2 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 8-(difluoromethyl)-1,6-naphthyridine |
| SMILES | FC(F)c1cncc2cccnc12 |
| InChI | InChI=1S/C9H6F2N2/c10-9(11)7-5-12-4-6-2-1-3-13-8(6)7/h1-5,9H |
| InChIKey | LNCWQOUZFKEHBR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(difluoromethyl)-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(difluoromethyl)-1,6-naphthyridine?
The IUPAC name of 8-(difluoromethyl)-1,6-naphthyridine (CID 163747519) is 8-(difluoromethyl)-1,6-naphthyridine.
What is the SMILES notation for 8-(difluoromethyl)-1,6-naphthyridine?
The canonical SMILES for 8-(difluoromethyl)-1,6-naphthyridine is FC(F)c1cncc2cccnc12.
What is the InChIKey of 8-(difluoromethyl)-1,6-naphthyridine?
The InChIKey is LNCWQOUZFKEHBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N2/c10-9(11)7-5-12-4-6-2-1-3-13-8(6)7/h1-5,9H.
What are the key properties of 8-(difluoromethyl)-1,6-naphthyridine?
8-(difluoromethyl)-1,6-naphthyridine has a molecular weight of 180.16 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(difluoromethyl)-1,6-naphthyridine is sourced from PubChem (CID 163747519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).