C12H15N3 — CID 91953467
N-butan-2-yl-1,6-naphthyridin-8-amine (PubChem CID 91953467) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-butan-2-yl-1,6-naphthyridin-8-amine.
| Compound Name | N-butan-2-yl-1,6-naphthyridin-8-amine |
|---|---|
| PubChem CID | 91953467 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-butan-2-yl-1,6-naphthyridin-8-amine |
| SMILES | CCC(C)Nc1cncc2cccnc12 |
| InChI | InChI=1S/C12H15N3/c1-3-9(2)15-11-8-13-7-10-5-4-6-14-12(10)11/h4-9,15H,3H2,1-2H3 |
| InChIKey | WZGMKTNIBSPIND-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |