C11H16F2N2O — CID 115922574
N-butan-2-yl-2-(2,2-difluoroethoxy)pyridin-3-amine (PubChem CID 115922574) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is N-butan-2-yl-2-(2,2-difluoroethoxy)pyridin-3-amine.
| Compound Name | N-butan-2-yl-2-(2,2-difluoroethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 115922574 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-butan-2-yl-2-(2,2-difluoroethoxy)pyridin-3-amine |
| SMILES | CCC(C)Nc1cccnc1OCC(F)F |
| InChI | InChI=1S/C11H16F2N2O/c1-3-8(2)15-9-5-4-6-14-11(9)16-7-10(12)13/h4-6,8,10,15H,3,7H2,1-2H3 |
| InChIKey | OQDNIUYEJKCGME-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |