C10H17N3O — CID 103388376
2-N-(2-ethoxy-3-pyridinyl)propane-1,2-diamine (PubChem CID 103388376) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-N-(2-ethoxy-3-pyridinyl)propane-1,2-diamine.
| Compound Name | 2-N-(2-ethoxy-3-pyridinyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103388376 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-N-(2-ethoxy-3-pyridinyl)propane-1,2-diamine |
| SMILES | CCOc1ncccc1NC(C)CN |
| InChI | InChI=1S/C10H17N3O/c1-3-14-10-9(5-4-6-12-10)13-8(2)7-11/h4-6,8,13H,3,7,11H2,1-2H3 |
| InChIKey | ZBTMNPYUMYUOOR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |