C9H15N3O — CID 55291895
(1R)-1-(2-ethoxy-3-pyridinyl)ethane-1,2-diamine (PubChem CID 55291895) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (1R)-1-(2-ethoxy-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(2-ethoxy-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55291895 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (1R)-1-(2-ethoxy-3-pyridinyl)ethane-1,2-diamine |
| SMILES | CCOc1ncccc1[C@@H](N)CN |
| InChI | InChI=1S/C9H15N3O/c1-2-13-9-7(8(11)6-10)4-3-5-12-9/h3-5,8H,2,6,10-11H2,1H3/t8-/m0/s1 |
| InChIKey | VQYKBOFTRJXGSD-QMMMGPOBSA-N |
| XLogP | 0.44 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |