About dimethyltin;bis(quinolin-8-ol)
dimethyltin;bis(quinolin-8-ol) (PubChem CID 50910182) has the molecular formula C20H20N2O2Sn
and a molecular weight of 439.10 g/mol. Its IUPAC name is dimethyltin;bis(quinolin-8-ol).
Molecular Properties
| Compound Name | dimethyltin;bis(quinolin-8-ol) |
| PubChem CID | 50910182 |
| Molecular Formula | C20H20N2O2Sn |
| Molecular Weight | 439.10 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | dimethyltin;bis(quinolin-8-ol) |
| SMILES | C[Sn]C.Oc1cccc2cccnc12.Oc1cccc2cccnc12 |
| InChI | InChI=1S/2C9H7NO.2CH3.Sn/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;;;/h2*1-6,11H;2*1H3; |
| InChIKey | YSHSOJUDUOACDO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyltin;bis(quinolin-8-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin;bis(quinolin-8-ol)?
The IUPAC name of dimethyltin;bis(quinolin-8-ol) (CID 50910182) is dimethyltin;bis(quinolin-8-ol).
What is the SMILES notation for dimethyltin;bis(quinolin-8-ol)?
The canonical SMILES for dimethyltin;bis(quinolin-8-ol) is C[Sn]C.Oc1cccc2cccnc12.Oc1cccc2cccnc12.
What is the InChIKey of dimethyltin;bis(quinolin-8-ol)?
The InChIKey is YSHSOJUDUOACDO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NO.2CH3.Sn/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;;;/h2*1-6,11H;2*1H3;.
What are the key properties of dimethyltin;bis(quinolin-8-ol)?
dimethyltin;bis(quinolin-8-ol) has a molecular weight of 439.10 g/mol, XLogP of 4.67, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin;bis(quinolin-8-ol) is sourced from PubChem (CID 50910182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).