About quinolin-8-ol;yttrium
quinolin-8-ol;yttrium (PubChem CID 174635627) has the molecular formula C9H7NOY
and a molecular weight of 234.07 g/mol. Its IUPAC name is quinolin-8-ol;yttrium.
Molecular Properties
| Compound Name | quinolin-8-ol;yttrium |
| PubChem CID | 174635627 |
| Molecular Formula | C9H7NOY |
| Molecular Weight | 234.07 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | quinolin-8-ol;yttrium |
| SMILES | Oc1cccc2cccnc12.[Y] |
| InChI | InChI=1S/C9H7NO.Y/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H; |
| InChIKey | YNCMEYMFVNDULI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.07 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-8-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-ol;yttrium?
The IUPAC name of quinolin-8-ol;yttrium (CID 174635627) is quinolin-8-ol;yttrium.
What is the SMILES notation for quinolin-8-ol;yttrium?
The canonical SMILES for quinolin-8-ol;yttrium is Oc1cccc2cccnc12.[Y].
What is the InChIKey of quinolin-8-ol;yttrium?
The InChIKey is YNCMEYMFVNDULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.Y/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;.
What are the key properties of quinolin-8-ol;yttrium?
quinolin-8-ol;yttrium has a molecular weight of 234.07 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-ol;yttrium is sourced from PubChem (CID 174635627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).