About 2-pyridin-2-ylpyridine;quinolin-8-ol
2-pyridin-2-ylpyridine;quinolin-8-ol (PubChem CID 67892593) has the molecular formula C19H15N3O
and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;quinolin-8-ol.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;quinolin-8-ol |
| PubChem CID | 67892593 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-pyridin-2-ylpyridine;quinolin-8-ol |
| SMILES | Oc1cccc2cccnc12.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C9H7NO/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;11-8-5-1-3-7-4-2-6-10-9(7)8/h1-8H;1-6,11H |
| InChIKey | DGSHPHGEANAFGZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyridin-2-ylpyridine;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;quinolin-8-ol?
The IUPAC name of 2-pyridin-2-ylpyridine;quinolin-8-ol (CID 67892593) is 2-pyridin-2-ylpyridine;quinolin-8-ol.
What is the SMILES notation for 2-pyridin-2-ylpyridine;quinolin-8-ol?
The canonical SMILES for 2-pyridin-2-ylpyridine;quinolin-8-ol is Oc1cccc2cccnc12.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;quinolin-8-ol?
The InChIKey is DGSHPHGEANAFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C9H7NO/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;11-8-5-1-3-7-4-2-6-10-9(7)8/h1-8H;1-6,11H.
What are the key properties of 2-pyridin-2-ylpyridine;quinolin-8-ol?
2-pyridin-2-ylpyridine;quinolin-8-ol has a molecular weight of 301.35 g/mol, XLogP of 4.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;quinolin-8-ol is sourced from PubChem (CID 67892593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).