About zinc quinolin-8-ol
zinc quinolin-8-ol (PubChem CID 22057723) has the molecular formula C9H7NOZn+2
and a molecular weight of 210.55 g/mol. Its IUPAC name is zinc quinolin-8-ol.
Molecular Properties
| Compound Name | zinc quinolin-8-ol |
| PubChem CID | 22057723 |
| Molecular Formula | C9H7NOZn+2 |
| Molecular Weight | 210.55 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | zinc quinolin-8-ol |
| SMILES | Oc1cccc2cccnc12.[Zn+2] |
| InChI | InChI=1S/C9H7NO.Zn/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;/q;+2 |
| InChIKey | YREFPCLTNHMZMO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc quinolin-8-ol?
The IUPAC name of zinc quinolin-8-ol (CID 22057723) is zinc quinolin-8-ol.
What is the SMILES notation for zinc quinolin-8-ol?
The canonical SMILES for zinc quinolin-8-ol is Oc1cccc2cccnc12.[Zn+2].
What is the InChIKey of zinc quinolin-8-ol?
The InChIKey is YREFPCLTNHMZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.Zn/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;/q;+2.
What are the key properties of zinc quinolin-8-ol?
zinc quinolin-8-ol has a molecular weight of 210.55 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc quinolin-8-ol is sourced from PubChem (CID 22057723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).