About methanol;quinolin-8-ol
methanol;quinolin-8-ol (PubChem CID 161490698) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is methanol;quinolin-8-ol.
Molecular Properties
| Compound Name | methanol;quinolin-8-ol |
| PubChem CID | 161490698 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | methanol;quinolin-8-ol |
| SMILES | CO.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO.CH4O/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2/h1-6,11H;2H,1H3 |
| InChIKey | WFOKLBTZOKAZFN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;quinolin-8-ol?
The IUPAC name of methanol;quinolin-8-ol (CID 161490698) is methanol;quinolin-8-ol.
What is the SMILES notation for methanol;quinolin-8-ol?
The canonical SMILES for methanol;quinolin-8-ol is CO.Oc1cccc2cccnc12.
What is the InChIKey of methanol;quinolin-8-ol?
The InChIKey is WFOKLBTZOKAZFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.CH4O/c11-8-5-1-3-7-4-2-6-10-9(7)8;1-2/h1-6,11H;2H,1H3.
What are the key properties of methanol;quinolin-8-ol?
methanol;quinolin-8-ol has a molecular weight of 177.20 g/mol, XLogP of 1.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;quinolin-8-ol is sourced from PubChem (CID 161490698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).