C12H8N2V — CID 174318955
1,7-phenanthroline;vanadium (PubChem CID 174318955) has the molecular formula C12H8N2V and a molecular weight of 231.15 g/mol. Its IUPAC name is 1,7-phenanthroline;vanadium.
| Compound Name | 1,7-phenanthroline;vanadium |
|---|---|
| PubChem CID | 174318955 |
| Molecular Formula | C12H8N2V |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 1,7-phenanthroline;vanadium |
| SMILES | [V].c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.V/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;/h1-8H; |
| InChIKey | KJRMZPGKOKVZAY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|