C32H48N6S8Sn — CID 174667242
tetrakis(N,N-diethylcarbamodithioate);1,7-phenanthroline;tin(4+) (PubChem CID 174667242) has the molecular formula C32H48N6S8Sn and a molecular weight of 892.02 g/mol. Its IUPAC name is tetrakis(N,N-diethylcarbamodithioate);1,7-phenanthroline;tin(4+).
| Compound Name | tetrakis(N,N-diethylcarbamodithioate);1,7-phenanthroline;tin(4+) |
|---|---|
| PubChem CID | 174667242 |
| Molecular Formula | C32H48N6S8Sn |
| Molecular Weight | 892.02 g/mol |
| Exact Mass | 892.07 |
| IUPAC Name | tetrakis(N,N-diethylcarbamodithioate);1,7-phenanthroline;tin(4+) |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Sn+4].c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.4C5H11NS2.Sn/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;4*1-3-6(4-2)5(7)8;/h1-8H;4*3-4H2,1-2H3,(H,7,8);/q;;;;;+4/p-4 |
| InChIKey | SOXLKTIGOPRKCB-UHFFFAOYSA-J |
| XLogP | 7.04 |
| TPSA | 38.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.02 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|