C17H14N4ORu — CID 175349925
1-(1H-imidazol-2-yl)ethanone;1,7-phenanthroline;ruthenium (PubChem CID 175349925) has the molecular formula C17H14N4ORu and a molecular weight of 391.40 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)ethanone;1,7-phenanthroline;ruthenium.
| Compound Name | 1-(1H-imidazol-2-yl)ethanone;1,7-phenanthroline;ruthenium |
|---|---|
| PubChem CID | 175349925 |
| Molecular Formula | C17H14N4ORu |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 1-(1H-imidazol-2-yl)ethanone;1,7-phenanthroline;ruthenium |
| SMILES | CC(=O)c1ncc[nH]1.[Ru].c1cnc2c(c1)ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2.C5H6N2O.Ru/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1;1-4(8)5-6-2-3-7-5;/h1-8H;2-3H,1H3,(H,6,7); |
| InChIKey | WOFLQUAQUHRFNL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|