C20H15N5O9 — CID 2749348
5-nitro-2-(2-phenylethenyl)aniline;2,4,6-trinitrophenol (PubChem CID 2749348) has the molecular formula C20H15N5O9 and a molecular weight of 469.37 g/mol. Its IUPAC name is 5-nitro-2-(2-phenylethenyl)aniline;2,4,6-trinitrophenol.
| Compound Name | 5-nitro-2-(2-phenylethenyl)aniline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 2749348 |
| Molecular Formula | C20H15N5O9 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 5-nitro-2-(2-phenylethenyl)aniline;2,4,6-trinitrophenol |
| SMILES | Nc1cc([N+](=O)[O-])ccc1C=Cc1ccccc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N2O2.C6H3N3O7/c15-14-10-13(16(17)18)9-8-12(14)7-6-11-4-2-1-3-5-11;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-10H,15H2;1-2,10H |
| InChIKey | QTJPVEZEGRKYHF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 218.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|