C24H18N4O8 — CID 54610786
6-methoxy-4-[(Z)-2-phenylethenyl]quinoline;2,4,6-trinitrophenol (PubChem CID 54610786) has the molecular formula C24H18N4O8 and a molecular weight of 490.43 g/mol. Its IUPAC name is 6-methoxy-4-[(Z)-2-phenylethenyl]quinoline;2,4,6-trinitrophenol.
| Compound Name | 6-methoxy-4-[(Z)-2-phenylethenyl]quinoline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 54610786 |
| Molecular Formula | C24H18N4O8 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 6-methoxy-4-[(Z)-2-phenylethenyl]quinoline;2,4,6-trinitrophenol |
| SMILES | COc1ccc2nccc(/C=C\c3ccccc3)c2c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15NO.C6H3N3O7/c1-20-16-9-10-18-17(13-16)15(11-12-19-18)8-7-14-5-3-2-4-6-14;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h2-13H,1H3;1-2,10H/b8-7-; |
| InChIKey | ZVQMFYHXDAYSRA-CFYXSCKTSA-N |
| XLogP | 5.53 |
| TPSA | 171.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|