C16H13N3O8 — CID 154881687
2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3,5-trinitrobenzene (PubChem CID 154881687) has the molecular formula C16H13N3O8 and a molecular weight of 375.29 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3,5-trinitrobenzene.
| Compound Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 154881687 |
| Molecular Formula | C16H13N3O8 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1,3,5-trinitrobenzene |
| SMILES | COc1ccc(/C=C/c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C16H13N3O8/c1-26-12-5-3-10(16(9-12)27-2)4-6-13-14(18(22)23)7-11(17(20)21)8-15(13)19(24)25/h3-9H,1-2H3/b6-4+ |
| InChIKey | HDZSGDRXJVNYPH-GQCTYLIASA-N |
| XLogP | 3.60 |
| TPSA | 147.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|