C26H26O4 — CID 171376648
1-[(Z)-2-[2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]ethenyl]-2,4-dimethoxybenzene (PubChem CID 171376648) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[(Z)-2-[2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]ethenyl]-2,4-dimethoxybenzene.
| Compound Name | 1-[(Z)-2-[2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]ethenyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 171376648 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[(Z)-2-[2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]ethenyl]-2,4-dimethoxybenzene |
| SMILES | COc1ccc(/C=C\c2ccccc2/C=C/c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H26O4/c1-27-23-15-13-21(25(17-23)29-3)11-9-19-7-5-6-8-20(19)10-12-22-14-16-24(28-2)18-26(22)30-4/h5-18H,1-4H3/b11-9-,12-10+ |
| InChIKey | AOLUMCPVEUKWBX-DSOJMZEYSA-N |
| XLogP | 6.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|