C10H13NO2 — CID 518060
1-(2,4-dimethoxyphenyl)-N-methylmethanimine (PubChem CID 518060) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-methylmethanimine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-methylmethanimine |
|---|---|
| PubChem CID | 518060 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-methylmethanimine |
| SMILES | C/N=C/c1ccc(OC)cc1OC |
| InChI | InChI=1S/C10H13NO2/c1-11-7-8-4-5-9(12-2)6-10(8)13-3/h4-7H,1-3H3/b11-7+ |
| InChIKey | SPJUMWVQDOLAGD-YRNVUSSQSA-N |
| XLogP | 1.75 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|