C20H25BF4N2O4 — CID 45050315
(E)-(2,4-dimethoxyphenyl)methylidene-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-ethylazanium tetrafluoroborate (PubChem CID 45050315) has the molecular formula C20H25BF4N2O4 and a molecular weight of 444.23 g/mol. Its IUPAC name is (E)-(2,4-dimethoxyphenyl)methylidene-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-ethylazanium tetrafluoroborate.
| Compound Name | (E)-(2,4-dimethoxyphenyl)methylidene-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-ethylazanium tetrafluoroborate |
|---|---|
| PubChem CID | 45050315 |
| Molecular Formula | C20H25BF4N2O4 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (E)-(2,4-dimethoxyphenyl)methylidene-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-ethylazanium tetrafluoroborate |
| SMILES | CC[N+](=C\c1ccc(OC)cc1OC)/N=C/c1ccc(OC)cc1OC.F[B-](F)(F)F |
| InChI | InChI=1S/C20H25N2O4.BF4/c1-6-22(14-16-8-10-18(24-3)12-20(16)26-5)21-13-15-7-9-17(23-2)11-19(15)25-4;2-1(3,4)5/h7-14H,6H2,1-5H3;/q+1;-1/b21-13+,22-14+; |
| InChIKey | BJGFKEICPRULSV-JKBLJYNNSA-N |
| XLogP | 4.51 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|