C17H19NO2S — CID 10756725
1-(2,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)methanimine (PubChem CID 10756725) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)methanimine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)methanimine |
|---|---|
| PubChem CID | 10756725 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)methanimine |
| SMILES | COc1ccc(/C=N/CCSc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C17H19NO2S/c1-19-15-9-8-14(17(12-15)20-2)13-18-10-11-21-16-6-4-3-5-7-16/h3-9,12-13H,10-11H2,1-2H3/b18-13+ |
| InChIKey | HVXBKVIKCJIQFS-QGOAFFKASA-N |
| XLogP | 3.91 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|