C26H36N2O4 — CID 136618032
2-[10-[(2-hydroxy-4-methoxyphenyl)methylideneamino]decyliminomethyl]-5-methoxyphenol (PubChem CID 136618032) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-[10-[(2-hydroxy-4-methoxyphenyl)methylideneamino]decyliminomethyl]-5-methoxyphenol.
| Compound Name | 2-[10-[(2-hydroxy-4-methoxyphenyl)methylideneamino]decyliminomethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 136618032 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-[10-[(2-hydroxy-4-methoxyphenyl)methylideneamino]decyliminomethyl]-5-methoxyphenol |
| SMILES | COc1ccc(/C=N/CCCCCCCCCC/N=C/c2ccc(OC)cc2O)c(O)c1 |
| InChI | InChI=1S/C26H36N2O4/c1-31-23-13-11-21(25(29)17-23)19-27-15-9-7-5-3-4-6-8-10-16-28-20-22-12-14-24(32-2)18-26(22)30/h11-14,17-20,29-30H,3-10,15-16H2,1-2H3/b27-19+,28-20+ |
| InChIKey | LVDMAAWHGKDQRV-MKYUKRCKSA-N |
| XLogP | 5.77 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|