C20H24MnN2O6 — CID 135509459
acetic acid;2-[2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]ethyliminomethyl]-5-methoxyphenol;manganese (PubChem CID 135509459) has the molecular formula C20H24MnN2O6 and a molecular weight of 443.36 g/mol. Its IUPAC name is acetic acid;2-[2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]ethyliminomethyl]-5-methoxyphenol;manganese.
| Compound Name | acetic acid;2-[2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]ethyliminomethyl]-5-methoxyphenol;manganese |
|---|---|
| PubChem CID | 135509459 |
| Molecular Formula | C20H24MnN2O6 |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | acetic acid;2-[2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]ethyliminomethyl]-5-methoxyphenol;manganese |
| SMILES | CC(=O)O.COc1ccc(/C=N/CC/N=C/c2ccc(OC)cc2O)c(O)c1.[Mn] |
| InChI | InChI=1S/C18H20N2O4.C2H4O2.Mn/c1-23-15-5-3-13(17(21)9-15)11-19-7-8-20-12-14-4-6-16(24-2)10-18(14)22;1-2(3)4;/h3-6,9-12,21-22H,7-8H2,1-2H3;1H3,(H,3,4);/b19-11+,20-12+;; |
| InChIKey | LTOTXUIDCIJJEP-GAMUHHASSA-N |
| XLogP | 2.74 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|