C14H19NO4 — CID 135937367
(2S)-2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-methylpentanoic acid (PubChem CID 135937367) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 135937367 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S)-2-[(2-hydroxy-4-methoxyphenyl)methylideneamino]-4-methylpentanoic acid |
| SMILES | COc1ccc(/C=N/[C@@H](CC(C)C)C(=O)O)c(O)c1 |
| InChI | InChI=1S/C14H19NO4/c1-9(2)6-12(14(17)18)15-8-10-4-5-11(19-3)7-13(10)16/h4-5,7-9,12,16H,6H2,1-3H3,(H,17,18)/b15-8+/t12-/m0/s1 |
| InChIKey | RKHNUMHVZMRENO-AAWHYMEISA-N |
| XLogP | 2.32 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|