C14H15N3O4 — CID 135929337
(2S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 135929337) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 135929337 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (2S)-2-[(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | COc1ccc(O)c(/C=N/[C@@H](Cc2cnc[nH]2)C(=O)O)c1 |
| InChI | InChI=1S/C14H15N3O4/c1-21-11-2-3-13(18)9(4-11)6-16-12(14(19)20)5-10-7-15-8-17-10/h2-4,6-8,12,18H,5H2,1H3,(H,15,17)(H,19,20)/b16-6+/t12-/m0/s1 |
| InChIKey | HIPIWNVHNVOURY-RVWHDZECSA-N |
| XLogP | 1.24 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|