C16H15CuNO3 — CID 137349128
copper;(2S)-2-[(2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid (PubChem CID 137349128) has the molecular formula C16H15CuNO3 and a molecular weight of 332.85 g/mol. Its IUPAC name is copper;(2S)-2-[(2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid.
| Compound Name | copper;(2S)-2-[(2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 137349128 |
| Molecular Formula | C16H15CuNO3 |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | copper;(2S)-2-[(2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)/N=C/c1ccccc1O.[Cu] |
| InChI | InChI=1S/C16H15NO3.Cu/c18-15-9-5-4-8-13(15)11-17-14(16(19)20)10-12-6-2-1-3-7-12;/h1-9,11,14,18H,10H2,(H,19,20);/b17-11+;/t14-;/m0./s1 |
| InChIKey | PPGHRPJWQTWFIW-VNKRLIBXSA-N |
| XLogP | 2.50 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|