C16H15NO6S — CID 136719290
2-[(2-hydroxy-5-sulfophenyl)methylideneamino]-3-phenylpropanoic acid (PubChem CID 136719290) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-sulfophenyl)methylideneamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(2-hydroxy-5-sulfophenyl)methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 136719290 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[(2-hydroxy-5-sulfophenyl)methylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)/N=C/c1cc(S(=O)(=O)O)ccc1O |
| InChI | InChI=1S/C16H15NO6S/c18-15-7-6-13(24(21,22)23)9-12(15)10-17-14(16(19)20)8-11-4-2-1-3-5-11/h1-7,9-10,14,18H,8H2,(H,19,20)(H,21,22,23)/b17-10+ |
| InChIKey | MSDYZJALCADGHQ-LICLKQGHSA-N |
| XLogP | 1.75 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|