C26H24N2O4 — CID 102584454
(2S)-2-[[4-[[(1S)-1-carboxy-2-phenylethyl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoic acid (PubChem CID 102584454) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S)-2-[[4-[[(1S)-1-carboxy-2-phenylethyl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[4-[[(1S)-1-carboxy-2-phenylethyl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 102584454 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (2S)-2-[[4-[[(1S)-1-carboxy-2-phenylethyl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)/N=C/c1ccc(/C=N/[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H24N2O4/c29-25(30)23(15-19-7-3-1-4-8-19)27-17-21-11-13-22(14-12-21)18-28-24(26(31)32)16-20-9-5-2-6-10-20/h1-14,17-18,23-24H,15-16H2,(H,29,30)(H,31,32)/b27-17+,28-18+/t23-,24-/m0/s1 |
| InChIKey | ASDPDEDQIHMYNX-KEMMBLORSA-N |
| XLogP | 3.92 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|