C16H15NO2 — CID 12560761
2-(benzylideneamino)-3-phenylpropanoic acid (PubChem CID 12560761) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(benzylideneamino)-3-phenylpropanoic acid.
| Compound Name | 2-(benzylideneamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 12560761 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(benzylideneamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)/N=C/c1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-16(19)15(11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10,12,15H,11H2,(H,18,19)/b17-12+ |
| InChIKey | GGUKWEDEPRDYOR-SFQUDFHCSA-N |
| XLogP | 2.80 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|