C26H24N2O — CID 172682950
(2S)-N-(4-ethenylphenyl)-2-[(4-ethenylphenyl)methylideneamino]-3-phenylpropanamide (PubChem CID 172682950) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is (2S)-N-(4-ethenylphenyl)-2-[(4-ethenylphenyl)methylideneamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-ethenylphenyl)-2-[(4-ethenylphenyl)methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 172682950 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (2S)-N-(4-ethenylphenyl)-2-[(4-ethenylphenyl)methylideneamino]-3-phenylpropanamide |
| SMILES | C=Cc1ccc(/C=N/[C@@H](Cc2ccccc2)C(=O)Nc2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O/c1-3-20-10-12-23(13-11-20)19-27-25(18-22-8-6-5-7-9-22)26(29)28-24-16-14-21(4-2)15-17-24/h3-17,19,25H,1-2,18H2,(H,28,29)/b27-19+/t25-/m0/s1 |
| InChIKey | AQPIYTGEUFGNCD-WINMZROPSA-N |
| XLogP | 5.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|