About 2-methyl-N-phenylprop-2-enamide;styrene
2-methyl-N-phenylprop-2-enamide;styrene (PubChem CID 70398128) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-methyl-N-phenylprop-2-enamide;styrene.
Molecular Properties
| Compound Name | 2-methyl-N-phenylprop-2-enamide;styrene |
| PubChem CID | 70398128 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-methyl-N-phenylprop-2-enamide;styrene |
| SMILES | C=C(C)C(=O)Nc1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO.C8H8/c1-8(2)10(12)11-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3,(H,11,12);2-7H,1H2 |
| InChIKey | GETBTEZQGYREAT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-phenylprop-2-enamide;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-phenylprop-2-enamide;styrene?
The IUPAC name of 2-methyl-N-phenylprop-2-enamide;styrene (CID 70398128) is 2-methyl-N-phenylprop-2-enamide;styrene.
What is the SMILES notation for 2-methyl-N-phenylprop-2-enamide;styrene?
The canonical SMILES for 2-methyl-N-phenylprop-2-enamide;styrene is C=C(C)C(=O)Nc1ccccc1.C=Cc1ccccc1.
What is the InChIKey of 2-methyl-N-phenylprop-2-enamide;styrene?
The InChIKey is GETBTEZQGYREAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C8H8/c1-8(2)10(12)11-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3,(H,11,12);2-7H,1H2.
What are the key properties of 2-methyl-N-phenylprop-2-enamide;styrene?
2-methyl-N-phenylprop-2-enamide;styrene has a molecular weight of 265.36 g/mol, XLogP of 4.53, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-phenylprop-2-enamide;styrene is sourced from PubChem (CID 70398128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).