C24H39NO — CID 174861897
N-dodecyl-2-methylprop-2-enamide;styrene (PubChem CID 174861897) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is N-dodecyl-2-methylprop-2-enamide;styrene.
| Compound Name | N-dodecyl-2-methylprop-2-enamide;styrene |
|---|---|
| PubChem CID | 174861897 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | N-dodecyl-2-methylprop-2-enamide;styrene |
| SMILES | C=C(C)C(=O)NCCCCCCCCCCCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C16H31NO.C8H8/c1-4-5-6-7-8-9-10-11-12-13-14-17-16(18)15(2)3;1-2-8-6-4-3-5-7-8/h2,4-14H2,1,3H3,(H,17,18);2-7H,1H2 |
| InChIKey | ZZOHPHAVDJSSLB-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|