C18H27NO2 — CID 69178102
2-methoxy-N-octyl-3-phenylprop-2-enamide (PubChem CID 69178102) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-methoxy-N-octyl-3-phenylprop-2-enamide.
| Compound Name | 2-methoxy-N-octyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69178102 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-methoxy-N-octyl-3-phenylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)C(=Cc1ccccc1)OC |
| InChI | InChI=1S/C18H27NO2/c1-3-4-5-6-7-11-14-19-18(20)17(21-2)15-16-12-9-8-10-13-16/h8-10,12-13,15H,3-7,11,14H2,1-2H3,(H,19,20) |
| InChIKey | LQRZVQMLFNWORD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|