C28H36O6 — CID 162017685
2-methoxy-3-phenylprop-2-enoic acid;octyl 2-methoxy-3-phenylprop-2-enoate (PubChem CID 162017685) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-methoxy-3-phenylprop-2-enoic acid;octyl 2-methoxy-3-phenylprop-2-enoate.
| Compound Name | 2-methoxy-3-phenylprop-2-enoic acid;octyl 2-methoxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162017685 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-methoxy-3-phenylprop-2-enoic acid;octyl 2-methoxy-3-phenylprop-2-enoate |
| SMILES | CCCCCCCCOC(=O)C(=Cc1ccccc1)OC.COC(=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H26O3.C10H10O3/c1-3-4-5-6-7-11-14-21-18(19)17(20-2)15-16-12-9-8-10-13-16;1-13-9(10(11)12)7-8-5-3-2-4-6-8/h8-10,12-13,15H,3-7,11,14H2,1-2H3;2-7H,1H3,(H,11,12) |
| InChIKey | YUIFLPUCUQIUND-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|