C21H24O2 — CID 87853239
3-pentoxy-1,4-diphenylbuta-1,3-dien-2-ol (PubChem CID 87853239) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-pentoxy-1,4-diphenylbuta-1,3-dien-2-ol.
| Compound Name | 3-pentoxy-1,4-diphenylbuta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 87853239 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-pentoxy-1,4-diphenylbuta-1,3-dien-2-ol |
| SMILES | CCCCCOC(=Cc1ccccc1)C(O)=Cc1ccccc1 |
| InChI | InChI=1S/C21H24O2/c1-2-3-10-15-23-21(17-19-13-8-5-9-14-19)20(22)16-18-11-6-4-7-12-18/h4-9,11-14,16-17,22H,2-3,10,15H2,1H3 |
| InChIKey | HRLGAJDCAWKBFB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|