C22H26O4 — CID 22557668
(Z)-2-hexoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (PubChem CID 22557668) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (Z)-2-hexoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-hexoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22557668 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (Z)-2-hexoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCO/C(=C\c1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H26O4/c1-2-3-4-8-15-25-21(22(23)24)16-18-11-13-20(14-12-18)26-17-19-9-6-5-7-10-19/h5-7,9-14,16H,2-4,8,15,17H2,1H3,(H,23,24)/b21-16- |
| InChIKey | GUDRNLGMERVUQU-PGMHBOJBSA-N |
| XLogP | 5.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|