About methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid
methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (PubChem CID 173177580) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| PubChem CID | 173177580 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid |
| SMILES | CN.COC(=Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C17H16O4.CH5N/c1-20-16(17(18)19)11-13-7-9-15(10-8-13)21-12-14-5-3-2-4-6-14;1-2/h2-11H,12H2,1H3,(H,18,19);2H2,1H3 |
| InChIKey | TVFOSRSHGKCNPK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid?
The IUPAC name of methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid (CID 173177580) is methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid.
What is the SMILES notation for methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid?
The canonical SMILES for methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid is CN.COC(=Cc1ccc(OCc2ccccc2)cc1)C(=O)O.
What is the InChIKey of methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid?
The InChIKey is TVFOSRSHGKCNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4.CH5N/c1-20-16(17(18)19)11-13-7-9-15(10-8-13)21-12-14-5-3-2-4-6-14;1-2/h2-11H,12H2,1H3,(H,18,19);2H2,1H3.
What are the key properties of methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid?
methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid has a molecular weight of 315.37 g/mol, XLogP of 2.91, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methoxy-3-(4-phenylmethoxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 173177580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).