C32H26O4 — CID 11248500
(2Z,3Z)-2,3-bis[(4-phenylmethoxyphenyl)methylidene]butanedial (PubChem CID 11248500) has the molecular formula C32H26O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is (2Z,3Z)-2,3-bis[(4-phenylmethoxyphenyl)methylidene]butanedial.
| Compound Name | (2Z,3Z)-2,3-bis[(4-phenylmethoxyphenyl)methylidene]butanedial |
|---|---|
| PubChem CID | 11248500 |
| Molecular Formula | C32H26O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2Z,3Z)-2,3-bis[(4-phenylmethoxyphenyl)methylidene]butanedial |
| SMILES | O=CC(=C\c1ccc(OCc2ccccc2)cc1)/C(C=O)=C/c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H26O4/c33-21-29(19-25-11-15-31(16-12-25)35-23-27-7-3-1-4-8-27)30(22-34)20-26-13-17-32(18-14-26)36-24-28-9-5-2-6-10-28/h1-22H,23-24H2/b29-19+,30-20+ |
| InChIKey | SSOHMODANPGQGE-CZYCKNNWSA-N |
| XLogP | 6.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|