C34H30O6 — CID 85426297
2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methylidene]butanedial (PubChem CID 85426297) has the molecular formula C34H30O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is 2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methylidene]butanedial.
| Compound Name | 2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methylidene]butanedial |
|---|---|
| PubChem CID | 85426297 |
| Molecular Formula | C34H30O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methylidene]butanedial |
| SMILES | COc1cc(C=C(C=O)C(C=O)=Cc2ccc(OCc3ccccc3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H30O6/c1-37-33-19-27(13-15-31(33)39-23-25-9-5-3-6-10-25)17-29(21-35)30(22-36)18-28-14-16-32(34(20-28)38-2)40-24-26-11-7-4-8-12-26/h3-22H,23-24H2,1-2H3 |
| InChIKey | HBBIIXFGMTVBMB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|