About zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-)
zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) (PubChem CID 158496796) has the molecular formula C18H26O4Zn
and a molecular weight of 371.79 g/mol. Its IUPAC name is zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-).
Molecular Properties
| Compound Name | zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) |
| PubChem CID | 158496796 |
| Molecular Formula | C18H26O4Zn |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) |
| SMILES | CCCCCCCCOC(=O)C(=Cc1ccccc1)OC.[O-2].[Zn+2] |
| InChI | InChI=1S/C18H26O3.O.Zn/c1-3-4-5-6-7-11-14-21-18(19)17(20-2)15-16-12-9-8-10-13-16;;/h8-10,12-13,15H,3-7,11,14H2,1-2H3;;/q;-2;+2 |
| InChIKey | HJJVFYZBRCRWNI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-)?
The IUPAC name of zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) (CID 158496796) is zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-).
What is the SMILES notation for zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-)?
The canonical SMILES for zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) is CCCCCCCCOC(=O)C(=Cc1ccccc1)OC.[O-2].[Zn+2].
What is the InChIKey of zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-)?
The InChIKey is HJJVFYZBRCRWNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3.O.Zn/c1-3-4-5-6-7-11-14-21-18(19)17(20-2)15-16-12-9-8-10-13-16;;/h8-10,12-13,15H,3-7,11,14H2,1-2H3;;/q;-2;+2.
What are the key properties of zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-)?
zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) has a molecular weight of 371.79 g/mol, XLogP of 4.46, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;octyl 2-methoxy-3-phenylprop-2-enoate;oxygen(2-) is sourced from PubChem (CID 158496796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).