C50H75NO8 — CID 174417760
4-amino-3,5-dimethyl-2-octylbenzoic acid;octyl 2-hydroxybenzoate;octyl 2-methoxy-3-phenylprop-2-enoate (PubChem CID 174417760) has the molecular formula C50H75NO8 and a molecular weight of 818.15 g/mol. Its IUPAC name is 4-amino-3,5-dimethyl-2-octylbenzoic acid;octyl 2-hydroxybenzoate;octyl 2-methoxy-3-phenylprop-2-enoate.
| Compound Name | 4-amino-3,5-dimethyl-2-octylbenzoic acid;octyl 2-hydroxybenzoate;octyl 2-methoxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 174417760 |
| Molecular Formula | C50H75NO8 |
| Molecular Weight | 818.15 g/mol |
| Exact Mass | 817.55 |
| IUPAC Name | 4-amino-3,5-dimethyl-2-octylbenzoic acid;octyl 2-hydroxybenzoate;octyl 2-methoxy-3-phenylprop-2-enoate |
| SMILES | CCCCCCCCOC(=O)C(=Cc1ccccc1)OC.CCCCCCCCOC(=O)c1ccccc1O.CCCCCCCCc1c(C(=O)O)cc(C)c(N)c1C |
| InChI | InChI=1S/C18H26O3.C17H27NO2.C15H22O3/c1-3-4-5-6-7-11-14-21-18(19)17(20-2)15-16-12-9-8-10-13-16;1-4-5-6-7-8-9-10-14-13(3)16(18)12(2)11-15(14)17(19)20;1-2-3-4-5-6-9-12-18-15(17)13-10-7-8-11-14(13)16/h8-10,12-13,15H,3-7,11,14H2,1-2H3;11H,4-10,18H2,1-3H3,(H,19,20);7-8,10-11,16H,2-6,9,12H2,1H3 |
| InChIKey | YRECAMBAAUKRDR-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.15 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|